C22H26N2O3S — CID 170502585
1-[3-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-2-methylphenyl]phenyl]ethanone (PubChem CID 170502585) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is 1-[3-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-2-methylphenyl]phenyl]ethanone.
| Compound Name | 1-[3-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-2-methylphenyl]phenyl]ethanone |
|---|---|
| PubChem CID | 170502585 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 1-[3-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-2-methylphenyl]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCN4CCCC4C3)cc2C)c1 |
| InChI | InChI=1S/C22H26N2O3S/c1-16-13-21(8-9-22(16)19-6-3-5-18(14-19)17(2)25)28(26,27)24-12-11-23-10-4-7-20(23)15-24/h3,5-6,8-9,13-14,20H,4,7,10-12,15H2,1-2H3 |
| InChIKey | RMWOTTJASWGPTD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |