C24H30N2O3S — CID 170504592
[(1S,3S,4S)-4-amino-3-hydroxycyclohexyl]-(2-phenylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)methanone (PubChem CID 170504592) has the molecular formula C24H30N2O3S and a molecular weight of 426.58 g/mol. Its IUPAC name is [(1S,3S,4S)-4-amino-3-hydroxycyclohexyl]-(2-phenylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)methanone.
| Compound Name | [(1S,3S,4S)-4-amino-3-hydroxycyclohexyl]-(2-phenylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)methanone |
|---|---|
| PubChem CID | 170504592 |
| Molecular Formula | C24H30N2O3S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | [(1S,3S,4S)-4-amino-3-hydroxycyclohexyl]-(2-phenylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)methanone |
| SMILES | N[C@H]1CC[C@H](C(=O)N2CCC3(CC2)OCCc2cc(-c4ccccc4)sc23)C[C@@H]1O |
| InChI | InChI=1S/C24H30N2O3S/c25-19-7-6-18(14-20(19)27)23(28)26-11-9-24(10-12-26)22-17(8-13-29-24)15-21(30-22)16-4-2-1-3-5-16/h1-5,15,18-20,27H,6-14,25H2/t18-,19-,20-/m0/s1 |
| InChIKey | OOZUOVCQMVLSQJ-UFYCRDLUSA-N |
| XLogP | 3.29 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |