C20H23N3O4 — CID 170505466
4-methyl-2-oxo-N-[2-(2-oxoimidazolidin-1-yl)ethyl]-6-(2-phenylethyl)pyran-3-carboxamide (PubChem CID 170505466) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-methyl-2-oxo-N-[2-(2-oxoimidazolidin-1-yl)ethyl]-6-(2-phenylethyl)pyran-3-carboxamide.
| Compound Name | 4-methyl-2-oxo-N-[2-(2-oxoimidazolidin-1-yl)ethyl]-6-(2-phenylethyl)pyran-3-carboxamide |
|---|---|
| PubChem CID | 170505466 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 4-methyl-2-oxo-N-[2-(2-oxoimidazolidin-1-yl)ethyl]-6-(2-phenylethyl)pyran-3-carboxamide |
| SMILES | Cc1cc(CCc2ccccc2)oc(=O)c1C(=O)NCCN1CCNC1=O |
| InChI | InChI=1S/C20H23N3O4/c1-14-13-16(8-7-15-5-3-2-4-6-15)27-19(25)17(14)18(24)21-9-11-23-12-10-22-20(23)26/h2-6,13H,7-12H2,1H3,(H,21,24)(H,22,26) |
| InChIKey | GFDQAMKBHGCYCO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |