C16H21N3O4 — CID 170502685
6-cyclobutyl-4-methyl-2-oxo-N-[2-(2-oxoimidazolidin-1-yl)ethyl]pyran-3-carboxamide (PubChem CID 170502685) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 6-cyclobutyl-4-methyl-2-oxo-N-[2-(2-oxoimidazolidin-1-yl)ethyl]pyran-3-carboxamide.
| Compound Name | 6-cyclobutyl-4-methyl-2-oxo-N-[2-(2-oxoimidazolidin-1-yl)ethyl]pyran-3-carboxamide |
|---|---|
| PubChem CID | 170502685 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 6-cyclobutyl-4-methyl-2-oxo-N-[2-(2-oxoimidazolidin-1-yl)ethyl]pyran-3-carboxamide |
| SMILES | Cc1cc(C2CCC2)oc(=O)c1C(=O)NCCN1CCNC1=O |
| InChI | InChI=1S/C16H21N3O4/c1-10-9-12(11-3-2-4-11)23-15(21)13(10)14(20)17-5-7-19-8-6-18-16(19)22/h9,11H,2-8H2,1H3,(H,17,20)(H,18,22) |
| InChIKey | JJMXGUMGQRQHLC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |