C19H28Cl2N4O3 — CID 171710778
4-methyl-N-[3-(4-methylpyrazol-1-yl)propyl]-2-oxo-6-piperidin-3-ylpyran-3-carboxamide;dihydrochloride (PubChem CID 171710778) has the molecular formula C19H28Cl2N4O3 and a molecular weight of 431.36 g/mol. Its IUPAC name is 4-methyl-N-[3-(4-methylpyrazol-1-yl)propyl]-2-oxo-6-piperidin-3-ylpyran-3-carboxamide;dihydrochloride.
| Compound Name | 4-methyl-N-[3-(4-methylpyrazol-1-yl)propyl]-2-oxo-6-piperidin-3-ylpyran-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 171710778 |
| Molecular Formula | C19H28Cl2N4O3 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 4-methyl-N-[3-(4-methylpyrazol-1-yl)propyl]-2-oxo-6-piperidin-3-ylpyran-3-carboxamide;dihydrochloride |
| SMILES | Cc1cnn(CCCNC(=O)c2c(C)cc(C3CCCNC3)oc2=O)c1.Cl.Cl |
| InChI | InChI=1S/C19H26N4O3.2ClH/c1-13-10-22-23(12-13)8-4-7-21-18(24)17-14(2)9-16(26-19(17)25)15-5-3-6-20-11-15;;/h9-10,12,15,20H,3-8,11H2,1-2H3,(H,21,24);2*1H |
| InChIKey | MGRZBYYDSCDHAQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|