C21H26N2O4 — CID 170512267
4-methyl-2-oxo-N-(2-phenylmethoxyethyl)-6-piperidin-3-ylpyran-3-carboxamide (PubChem CID 170512267) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 4-methyl-2-oxo-N-(2-phenylmethoxyethyl)-6-piperidin-3-ylpyran-3-carboxamide.
| Compound Name | 4-methyl-2-oxo-N-(2-phenylmethoxyethyl)-6-piperidin-3-ylpyran-3-carboxamide |
|---|---|
| PubChem CID | 170512267 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 4-methyl-2-oxo-N-(2-phenylmethoxyethyl)-6-piperidin-3-ylpyran-3-carboxamide |
| SMILES | Cc1cc(C2CCCNC2)oc(=O)c1C(=O)NCCOCc1ccccc1 |
| InChI | InChI=1S/C21H26N2O4/c1-15-12-18(17-8-5-9-22-13-17)27-21(25)19(15)20(24)23-10-11-26-14-16-6-3-2-4-7-16/h2-4,6-7,12,17,22H,5,8-11,13-14H2,1H3,(H,23,24) |
| InChIKey | OOXJHZHGFDMXLQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|