C20H22N4O3 — CID 170513093
N-(1H-benzimidazol-2-ylmethyl)-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide (PubChem CID 170513093) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide |
|---|---|
| PubChem CID | 170513093 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide |
| SMILES | Cc1cc(C2CCCNC2)oc(=O)c1C(=O)NCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H22N4O3/c1-12-9-16(13-5-4-8-21-10-13)27-20(26)18(12)19(25)22-11-17-23-14-6-2-3-7-15(14)24-17/h2-3,6-7,9,13,21H,4-5,8,10-11H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | GBWWTWWLEUAGBJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |