C23H24N2O4 — CID 170507014
4-methyl-6-(oxan-4-yl)-3-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)pyran-2-one (PubChem CID 170507014) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 4-methyl-6-(oxan-4-yl)-3-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)pyran-2-one.
| Compound Name | 4-methyl-6-(oxan-4-yl)-3-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)pyran-2-one |
|---|---|
| PubChem CID | 170507014 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 4-methyl-6-(oxan-4-yl)-3-(1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)pyran-2-one |
| SMILES | Cc1cc(C2CCOCC2)oc(=O)c1C(=O)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C23H24N2O4/c1-14-12-20(15-7-10-28-11-8-15)29-23(27)21(14)22(26)25-9-6-19-17(13-25)16-4-2-3-5-18(16)24-19/h2-5,12,15,24H,6-11,13H2,1H3 |
| InChIKey | MOHZVCIIIJDSNI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 75.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|