C22H26N4O3 — CID 170507137
N-(2-ethyl-1-methylbenzimidazol-5-yl)-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide (PubChem CID 170507137) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-(2-ethyl-1-methylbenzimidazol-5-yl)-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide.
| Compound Name | N-(2-ethyl-1-methylbenzimidazol-5-yl)-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide |
|---|---|
| PubChem CID | 170507137 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-(2-ethyl-1-methylbenzimidazol-5-yl)-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide |
| SMILES | CCc1nc2cc(NC(=O)c3c(C)cc(C4CCCNC4)oc3=O)ccc2n1C |
| InChI | InChI=1S/C22H26N4O3/c1-4-19-25-16-11-15(7-8-17(16)26(19)3)24-21(27)20-13(2)10-18(29-22(20)28)14-6-5-9-23-12-14/h7-8,10-11,14,23H,4-6,9,12H2,1-3H3,(H,24,27) |
| InChIKey | BEJSURXLRCEHLC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |