C20H26N4O5S — CID 170504605
N-[3-(dimethylsulfamoylamino)phenyl]-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide (PubChem CID 170504605) has the molecular formula C20H26N4O5S and a molecular weight of 434.52 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoylamino)phenyl]-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide.
| Compound Name | N-[3-(dimethylsulfamoylamino)phenyl]-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide |
|---|---|
| PubChem CID | 170504605 |
| Molecular Formula | C20H26N4O5S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-[3-(dimethylsulfamoylamino)phenyl]-4-methyl-2-oxo-6-piperidin-3-ylpyran-3-carboxamide |
| SMILES | Cc1cc(C2CCCNC2)oc(=O)c1C(=O)Nc1cccc(NS(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C20H26N4O5S/c1-13-10-17(14-6-5-9-21-12-14)29-20(26)18(13)19(25)22-15-7-4-8-16(11-15)23-30(27,28)24(2)3/h4,7-8,10-11,14,21,23H,5-6,9,12H2,1-3H3,(H,22,25) |
| InChIKey | JMPZDDLGELSHCK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |