C19H19NO5 — CID 170505549
methyl 3-[(6-cyclobutyl-4-methyl-2-oxopyran-3-carbonyl)amino]benzoate (PubChem CID 170505549) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is methyl 3-[(6-cyclobutyl-4-methyl-2-oxopyran-3-carbonyl)amino]benzoate.
| Compound Name | methyl 3-[(6-cyclobutyl-4-methyl-2-oxopyran-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 170505549 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | methyl 3-[(6-cyclobutyl-4-methyl-2-oxopyran-3-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2c(C)cc(C3CCC3)oc2=O)c1 |
| InChI | InChI=1S/C19H19NO5/c1-11-9-15(12-5-3-6-12)25-19(23)16(11)17(21)20-14-8-4-7-13(10-14)18(22)24-2/h4,7-10,12H,3,5-6H2,1-2H3,(H,20,21) |
| InChIKey | SRGMCCWTOIXEOY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |