C23H30N6O — CID 170511777
2-[4-[4-[[1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl(methyl)amino]methyl]phenyl]pyrazol-1-yl]propanamide (PubChem CID 170511777) has the molecular formula C23H30N6O and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-[4-[4-[[1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl(methyl)amino]methyl]phenyl]pyrazol-1-yl]propanamide.
| Compound Name | 2-[4-[4-[[1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl(methyl)amino]methyl]phenyl]pyrazol-1-yl]propanamide |
|---|---|
| PubChem CID | 170511777 |
| Molecular Formula | C23H30N6O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 2-[4-[4-[[1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl(methyl)amino]methyl]phenyl]pyrazol-1-yl]propanamide |
| SMILES | CC(C(N)=O)n1cc(-c2ccc(CN(C)Cc3n[nH]c4c3CCCCC4)cc2)cn1 |
| InChI | InChI=1S/C23H30N6O/c1-16(23(24)30)29-14-19(12-25-29)18-10-8-17(9-11-18)13-28(2)15-22-20-6-4-3-5-7-21(20)26-27-22/h8-12,14,16H,3-7,13,15H2,1-2H3,(H2,24,30)(H,26,27) |
| InChIKey | JTDUQPBFVINUOQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |