C22H28N2O5 — CID 170511810
N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-4-methyl-6-(oxan-4-yl)-2-oxopyran-3-carboxamide (PubChem CID 170511810) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-4-methyl-6-(oxan-4-yl)-2-oxopyran-3-carboxamide.
| Compound Name | N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-4-methyl-6-(oxan-4-yl)-2-oxopyran-3-carboxamide |
|---|---|
| PubChem CID | 170511810 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-4-methyl-6-(oxan-4-yl)-2-oxopyran-3-carboxamide |
| SMILES | Cc1cc(C2CCOCC2)oc(=O)c1C(=O)NCC(c1ccco1)N1CCCC1 |
| InChI | InChI=1S/C22H28N2O5/c1-15-13-19(16-6-11-27-12-7-16)29-22(26)20(15)21(25)23-14-17(18-5-4-10-28-18)24-8-2-3-9-24/h4-5,10,13,16-17H,2-3,6-9,11-12,14H2,1H3,(H,23,25) |
| InChIKey | VOOPKGBUPGFOSY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |