C31H18N4 — CID 170514345
(9R)-6-isocyano-9-(6-phenyl-2-pyridinyl)-9-pyridin-2-ylfluorene-3-carbonitrile (PubChem CID 170514345) has the molecular formula C31H18N4 and a molecular weight of 446.51 g/mol. Its IUPAC name is (9R)-6-isocyano-9-(6-phenyl-2-pyridinyl)-9-pyridin-2-ylfluorene-3-carbonitrile.
| Compound Name | (9R)-6-isocyano-9-(6-phenyl-2-pyridinyl)-9-pyridin-2-ylfluorene-3-carbonitrile |
|---|---|
| PubChem CID | 170514345 |
| Molecular Formula | C31H18N4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | (9R)-6-isocyano-9-(6-phenyl-2-pyridinyl)-9-pyridin-2-ylfluorene-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)-c1cc(C#N)ccc1[C@@]2(c1ccccn1)c1cccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C31H18N4/c1-33-23-14-16-27-25(19-23)24-18-21(20-32)13-15-26(24)31(27,29-11-5-6-17-34-29)30-12-7-10-28(35-30)22-8-3-2-4-9-22/h2-19H/t31-/m1/s1 |
| InChIKey | LRNUJGHDGZOZMW-WJOKGBTCSA-N |
| XLogP | 6.93 |
| TPSA | 53.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|