C37H31N5 — CID 170514496
2-[9-[3-[3-(3-methyl-1-phenyl-2,4-dihydroimidazole-1,3-diium-2,4-diid-3-yl)-2H-imidazol-1-yl]phenyl]fluoren-9-yl]pyridine (PubChem CID 170514496) has the molecular formula C37H31N5 and a molecular weight of 545.69 g/mol. Its IUPAC name is 2-[9-[3-[3-(3-methyl-1-phenyl-2,4-dihydroimidazole-1,3-diium-2,4-diid-3-yl)-2H-imidazol-1-yl]phenyl]fluoren-9-yl]pyridine.
| Compound Name | 2-[9-[3-[3-(3-methyl-1-phenyl-2,4-dihydroimidazole-1,3-diium-2,4-diid-3-yl)-2H-imidazol-1-yl]phenyl]fluoren-9-yl]pyridine |
|---|---|
| PubChem CID | 170514496 |
| Molecular Formula | C37H31N5 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | 2-[9-[3-[3-(3-methyl-1-phenyl-2,4-dihydroimidazole-1,3-diium-2,4-diid-3-yl)-2H-imidazol-1-yl]phenyl]fluoren-9-yl]pyridine |
| SMILES | C[N+]1(N2C=CN(c3cccc(C4(c5ccccn5)c5ccccc5-c5ccccc54)c3)C2)[CH-]C=[N+](c2ccccc2)[CH-]1 |
| InChI | InChI=1S/C37H31N5/c1-42(25-24-40(28-42)30-13-3-2-4-14-30)41-23-22-39(27-41)31-15-11-12-29(26-31)37(36-20-9-10-21-38-36)34-18-7-5-16-32(34)33-17-6-8-19-35(33)37/h2-26,28H,27H2,1H3 |
| InChIKey | WVXQIQCYGXEXAO-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 22.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|