C49H35B3N8 — CID 170518529
10-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)-3,16-bis(3-phenylphenyl)-1,7,13-triaza-2,8,14-triboratetracyclo[12.4.0.02,7.08,13]octadeca-3,5,9,11,15,17-hexaene (PubChem CID 170518529) has the molecular formula C49H35B3N8 and a molecular weight of 768.31 g/mol. Its IUPAC name is 10-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)-3,16-bis(3-phenylphenyl)-1,7,13-triaza-2,8,14-triboratetracyclo[12.4.0.02,7.08,13]octadeca-3,5,9,11,15,17-hexaene.
| Compound Name | 10-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)-3,16-bis(3-phenylphenyl)-1,7,13-triaza-2,8,14-triboratetracyclo[12.4.0.02,7.08,13]octadeca-3,5,9,11,15,17-hexaene |
|---|---|
| PubChem CID | 170518529 |
| Molecular Formula | C49H35B3N8 |
| Molecular Weight | 768.31 g/mol |
| Exact Mass | 768.33 |
| IUPAC Name | 10-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)-3,16-bis(3-phenylphenyl)-1,7,13-triaza-2,8,14-triboratetracyclo[12.4.0.02,7.08,13]octadeca-3,5,9,11,15,17-hexaene |
| SMILES | C1=CN2B3C=C(c4nc(-c5ccncc5)nc(-c5ccncc5)n4)C=CN3B3C=C(c4cccc(-c5ccccc5)c4)C=CN3B2C(c2cccc(-c3ccccc3)c2)=C1 |
| InChI | InChI=1S/C49H35B3N8/c1-3-10-36(11-4-1)40-14-7-16-42(32-40)44-23-31-60-50(34-44)58-30-24-45(49-56-47(38-19-25-53-26-20-38)55-48(57-49)39-21-27-54-28-22-39)35-51(58)59-29-9-18-46(52(59)60)43-17-8-15-41(33-43)37-12-5-2-6-13-37/h1-35H |
| InChIKey | JZSKAWHWNWEONR-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 74.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.31 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|