C45H33B3N6 — CID 170518396
4-[2-phenyl-4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,7,13-triaza-2,8,14-triboratetracyclo[12.4.0.02,7.08,13]octadeca-3,5,9,11,15,17-hexaene (PubChem CID 170518396) has the molecular formula C45H33B3N6 and a molecular weight of 690.24 g/mol. Its IUPAC name is 4-[2-phenyl-4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,7,13-triaza-2,8,14-triboratetracyclo[12.4.0.02,7.08,13]octadeca-3,5,9,11,15,17-hexaene.
| Compound Name | 4-[2-phenyl-4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,7,13-triaza-2,8,14-triboratetracyclo[12.4.0.02,7.08,13]octadeca-3,5,9,11,15,17-hexaene |
|---|---|
| PubChem CID | 170518396 |
| Molecular Formula | C45H33B3N6 |
| Molecular Weight | 690.24 g/mol |
| Exact Mass | 690.30 |
| IUPAC Name | 4-[2-phenyl-4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,7,13-triaza-2,8,14-triboratetracyclo[12.4.0.02,7.08,13]octadeca-3,5,9,11,15,17-hexaene |
| SMILES | C1=CB2N3C=CC=CB3N3C=CC(c4ccc(-c5nc(-c6ccccc6)nc(-c6ccc(-c7ccccc7)cc6)n5)cc4-c4ccccc4)=CB3N2C=C1 |
| InChI | InChI=1S/C45H33B3N6/c1-4-14-34(15-5-1)35-20-22-38(23-21-35)44-49-43(37-18-8-3-9-19-37)50-45(51-44)39-24-25-41(42(32-39)36-16-6-2-7-17-36)40-26-31-54-47-28-10-12-29-52(47)46-27-11-13-30-53(46)48(54)33-40/h1-33H |
| InChIKey | DLOBRRZSSAGDCC-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.24 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|