C39H29B3N6 — CID 170518477
5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-phenylphenyl]-1,7,13-triaza-2,8,14-triboratetracyclo[12.4.0.02,7.08,13]octadeca-3,5,9,11,15,17-hexaene (PubChem CID 170518477) has the molecular formula C39H29B3N6 and a molecular weight of 614.14 g/mol. Its IUPAC name is 5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-phenylphenyl]-1,7,13-triaza-2,8,14-triboratetracyclo[12.4.0.02,7.08,13]octadeca-3,5,9,11,15,17-hexaene.
| Compound Name | 5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-phenylphenyl]-1,7,13-triaza-2,8,14-triboratetracyclo[12.4.0.02,7.08,13]octadeca-3,5,9,11,15,17-hexaene |
|---|---|
| PubChem CID | 170518477 |
| Molecular Formula | C39H29B3N6 |
| Molecular Weight | 614.14 g/mol |
| Exact Mass | 614.27 |
| IUPAC Name | 5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-phenylphenyl]-1,7,13-triaza-2,8,14-triboratetracyclo[12.4.0.02,7.08,13]octadeca-3,5,9,11,15,17-hexaene |
| SMILES | C1=CB2N3C=CC=CB3N3C=C(c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4-c4ccccc4)C=CB3N2C=C1 |
| InChI | InChI=1S/C39H29B3N6/c1-4-14-30(15-5-1)36-28-33(39-44-37(31-16-6-2-7-17-31)43-38(45-39)32-18-8-3-9-19-32)20-21-35(36)34-22-25-42-47-27-12-10-23-40(47)46-26-13-11-24-41(46)48(42)29-34/h1-29H |
| InChIKey | PEGZLQVIVOFJJY-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.14 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|