C37H27B3N6 — CID 170518553
11-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-phenyl-2,8,14-triaza-1,7,13-triborapentacyclo[12.8.0.02,7.08,13.015,20]docosa-3,5,9,11,15,17,19,21-octaene (PubChem CID 170518553) has the molecular formula C37H27B3N6 and a molecular weight of 588.10 g/mol. Its IUPAC name is 11-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-phenyl-2,8,14-triaza-1,7,13-triborapentacyclo[12.8.0.02,7.08,13.015,20]docosa-3,5,9,11,15,17,19,21-octaene.
| Compound Name | 11-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-phenyl-2,8,14-triaza-1,7,13-triborapentacyclo[12.8.0.02,7.08,13.015,20]docosa-3,5,9,11,15,17,19,21-octaene |
|---|---|
| PubChem CID | 170518553 |
| Molecular Formula | C37H27B3N6 |
| Molecular Weight | 588.10 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | 11-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-phenyl-2,8,14-triaza-1,7,13-triborapentacyclo[12.8.0.02,7.08,13.015,20]docosa-3,5,9,11,15,17,19,21-octaene |
| SMILES | C1=CC(c2ccccc2)=CN2B1N1C=CC(c3nc(-c4ccccc4)nc(-c4ccccc4)n3)=CB1N1B2C=Cc2ccccc21 |
| InChI | InChI=1S/C37H27B3N6/c1-4-12-28(13-5-1)33-21-23-38-44-25-22-32(26-40(44)46-34-19-11-10-14-29(34)20-24-39(46)45(38)27-33)37-42-35(30-15-6-2-7-16-30)41-36(43-37)31-17-8-3-9-18-31/h1-27H |
| InChIKey | LFFQAHYNSDYIGY-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.10 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|