C31H61NO2Si — CID 170522349
[(2S)-1-[2-[tert-butyl-bis(5-methyl-2-propan-2-ylcyclohexyl)silyl]oxyethyl]pyrrolidin-2-yl]methanol (PubChem CID 170522349) has the molecular formula C31H61NO2Si and a molecular weight of 507.92 g/mol. Its IUPAC name is [(2S)-1-[2-[tert-butyl-bis(5-methyl-2-propan-2-ylcyclohexyl)silyl]oxyethyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[2-[tert-butyl-bis(5-methyl-2-propan-2-ylcyclohexyl)silyl]oxyethyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 170522349 |
| Molecular Formula | C31H61NO2Si |
| Molecular Weight | 507.92 g/mol |
| Exact Mass | 507.45 |
| IUPAC Name | [(2S)-1-[2-[tert-butyl-bis(5-methyl-2-propan-2-ylcyclohexyl)silyl]oxyethyl]pyrrolidin-2-yl]methanol |
| SMILES | CC1CCC(C(C)C)C([Si](OCCN2CCC[C@H]2CO)(C2CC(C)CCC2C(C)C)C(C)(C)C)C1 |
| InChI | InChI=1S/C31H61NO2Si/c1-22(2)27-14-12-24(5)19-29(27)35(31(7,8)9,30-20-25(6)13-15-28(30)23(3)4)34-18-17-32-16-10-11-26(32)21-33/h22-30,33H,10-21H2,1-9H3/t24?,25?,26-,27?,28?,29?,30?,35?/m0/s1 |
| InChIKey | JANWVDJPEQSLNN-VKIALIFBSA-N |
| XLogP | 8.13 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.92 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|