C20H23N5O7 — CID 170527030
[(3aS,4R,6S,6aS)-6-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-isocyano-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methyl [(3S)-oxolan-3-yl] carbonate (PubChem CID 170527030) has the molecular formula C20H23N5O7 and a molecular weight of 445.43 g/mol. Its IUPAC name is [(3aS,4R,6S,6aS)-6-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-isocyano-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methyl [(3S)-oxolan-3-yl] carbonate.
| Compound Name | [(3aS,4R,6S,6aS)-6-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-isocyano-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methyl [(3S)-oxolan-3-yl] carbonate |
|---|---|
| PubChem CID | 170527030 |
| Molecular Formula | C20H23N5O7 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | [(3aS,4R,6S,6aS)-6-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-isocyano-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methyl [(3S)-oxolan-3-yl] carbonate |
| SMILES | [C-]#[N+][C@]1(COC(=O)O[C@H]2CCOC2)O[C@@H](c2ccc3c(N)ncnn23)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C20H23N5O7/c1-19(2)30-15-14(12-4-5-13-17(21)23-10-24-25(12)13)31-20(22-3,16(15)32-19)9-28-18(26)29-11-6-7-27-8-11/h4-5,10-11,14-16H,6-9H2,1-2H3,(H2,21,23,24)/t11-,14-,15-,16-,20+/m0/s1 |
| InChIKey | LMAZCNFXLYQVIZ-SGRUUWOSSA-N |
| XLogP | 1.46 |
| TPSA | 133.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|