C17H22N4O7 — CID 170205738
[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl oxan-4-yl carbonate (PubChem CID 170205738) has the molecular formula C17H22N4O7 and a molecular weight of 394.38 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl oxan-4-yl carbonate.
| Compound Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl oxan-4-yl carbonate |
|---|---|
| PubChem CID | 170205738 |
| Molecular Formula | C17H22N4O7 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl oxan-4-yl carbonate |
| SMILES | Nc1ncnn2c([C@@H]3O[C@H](COC(=O)OC4CCOCC4)[C@@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C17H22N4O7/c18-16-11-2-1-10(21(11)20-8-19-16)15-14(23)13(22)12(28-15)7-26-17(24)27-9-3-5-25-6-4-9/h1-2,8-9,12-15,22-23H,3-7H2,(H2,18,19,20)/t12-,13-,14-,15+/m1/s1 |
| InChIKey | ONMOAJPYHFKURI-TUVASFSCSA-N |
| XLogP | -0.19 |
| TPSA | 150.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |