C19H26N4O5 — CID 170057948
[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2-cyclohexylacetate (PubChem CID 170057948) has the molecular formula C19H26N4O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2-cyclohexylacetate.
| Compound Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2-cyclohexylacetate |
|---|---|
| PubChem CID | 170057948 |
| Molecular Formula | C19H26N4O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | [(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl 2-cyclohexylacetate |
| SMILES | Nc1ncnn2c([C@@H]3O[C@H](COC(=O)CC4CCCCC4)[C@@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C19H26N4O5/c20-19-13-7-6-12(23(13)22-10-21-19)18-17(26)16(25)14(28-18)9-27-15(24)8-11-4-2-1-3-5-11/h6-7,10-11,14,16-18,25-26H,1-5,8-9H2,(H2,20,21,22)/t14-,16-,17-,18+/m1/s1 |
| InChIKey | LHYOSKDTQGWPPN-DDBAPUKQSA-N |
| XLogP | 0.99 |
| TPSA | 132.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |