C5H8N4OS2 — CID 17052825
N'-hydroxy-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethanimidamide (PubChem CID 17052825) has the molecular formula C5H8N4OS2 and a molecular weight of 204.28 g/mol. Its IUPAC name is N'-hydroxy-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethanimidamide.
| Compound Name | N'-hydroxy-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethanimidamide |
|---|---|
| PubChem CID | 17052825 |
| Molecular Formula | C5H8N4OS2 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | N'-hydroxy-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethanimidamide |
| SMILES | Cc1nnc(SC/C(N)=N/O)s1 |
| InChI | InChI=1S/C5H8N4OS2/c1-3-7-8-5(12-3)11-2-4(6)9-10/h10H,2H2,1H3,(H2,6,9) |
| InChIKey | JMKDLYHTYJJJTC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|