C7H10N2S3 — CID 103074170
2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]prop-2-ene-1-thiol (PubChem CID 103074170) has the molecular formula C7H10N2S3 and a molecular weight of 218.37 g/mol. Its IUPAC name is 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]prop-2-ene-1-thiol.
| Compound Name | 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 103074170 |
| Molecular Formula | C7H10N2S3 |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]prop-2-ene-1-thiol |
| SMILES | C=C(CS)CSc1nnc(C)s1 |
| InChI | InChI=1S/C7H10N2S3/c1-5(3-10)4-11-7-9-8-6(2)12-7/h10H,1,3-4H2,2H3 |
| InChIKey | WAXLWKIFRAYWKY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|