C9H13NOS2 — CID 106928156
2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanylmethyl]prop-2-ene-1-thiol (PubChem CID 106928156) has the molecular formula C9H13NOS2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanylmethyl]prop-2-ene-1-thiol.
| Compound Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanylmethyl]prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 106928156 |
| Molecular Formula | C9H13NOS2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanylmethyl]prop-2-ene-1-thiol |
| SMILES | C=C(CS)CSc1nc(C)c(C)o1 |
| InChI | InChI=1S/C9H13NOS2/c1-6(4-12)5-13-9-10-7(2)8(3)11-9/h12H,1,4-5H2,2-3H3 |
| InChIKey | UXPZNCHRPOVXSM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|