About 2-(cyclopropylmethylsulfanyl)-4,5-dimethyl-1,3-oxazole
2-(cyclopropylmethylsulfanyl)-4,5-dimethyl-1,3-oxazole (PubChem CID 131207208) has the molecular formula C9H13NOS
and a molecular weight of 183.28 g/mol. Its IUPAC name is 2-(cyclopropylmethylsulfanyl)-4,5-dimethyl-1,3-oxazole.
Analyze 2-(cyclopropylmethylsulfanyl)-4,5-dimethyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopropylmethylsulfanyl)-4,5-dimethyl-1,3-oxazole?
The IUPAC name of 2-(cyclopropylmethylsulfanyl)-4,5-dimethyl-1,3-oxazole (CID 131207208) is 2-(cyclopropylmethylsulfanyl)-4,5-dimethyl-1,3-oxazole.
What is the SMILES notation for 2-(cyclopropylmethylsulfanyl)-4,5-dimethyl-1,3-oxazole?
The canonical SMILES for 2-(cyclopropylmethylsulfanyl)-4,5-dimethyl-1,3-oxazole is Cc1nc(SCC2CC2)oc1C.
What is the InChIKey of 2-(cyclopropylmethylsulfanyl)-4,5-dimethyl-1,3-oxazole?
The InChIKey is JQVCZISKHDAFFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NOS/c1-6-7(2)11-9(10-6)12-5-8-3-4-8/h8H,3-5H2,1-2H3.
What are the key properties of 2-(cyclopropylmethylsulfanyl)-4,5-dimethyl-1,3-oxazole?
2-(cyclopropylmethylsulfanyl)-4,5-dimethyl-1,3-oxazole has a molecular weight of 183.28 g/mol, XLogP of 2.79, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopropylmethylsulfanyl)-4,5-dimethyl-1,3-oxazole is sourced from PubChem (CID 131207208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).