C16H30F3N3O2 — CID 170529661
N-propan-2-yl-2-[(2S)-4-(3-propan-2-yloxypropyl)-2-(trifluoromethyl)piperazin-1-yl]acetamide (PubChem CID 170529661) has the molecular formula C16H30F3N3O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is N-propan-2-yl-2-[(2S)-4-(3-propan-2-yloxypropyl)-2-(trifluoromethyl)piperazin-1-yl]acetamide.
| Compound Name | N-propan-2-yl-2-[(2S)-4-(3-propan-2-yloxypropyl)-2-(trifluoromethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 170529661 |
| Molecular Formula | C16H30F3N3O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | N-propan-2-yl-2-[(2S)-4-(3-propan-2-yloxypropyl)-2-(trifluoromethyl)piperazin-1-yl]acetamide |
| SMILES | CC(C)NC(=O)CN1CCN(CCCOC(C)C)C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C16H30F3N3O2/c1-12(2)20-15(23)11-22-8-7-21(6-5-9-24-13(3)4)10-14(22)16(17,18)19/h12-14H,5-11H2,1-4H3,(H,20,23)/t14-/m0/s1 |
| InChIKey | BOWWTWBWRWLZNG-AWEZNQCLSA-N |
| XLogP | 1.87 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|