C28H21N3Pt — CID 170529903
N-phenyl-6-phenyl-N-(2-phenyl-1,2-dihydropyridin-6-yl)pyridin-2-amine;platinum(2+) (PubChem CID 170529903) has the molecular formula C28H21N3Pt and a molecular weight of 594.58 g/mol. Its IUPAC name is N-phenyl-6-phenyl-N-(2-phenyl-1,2-dihydropyridin-6-yl)pyridin-2-amine;platinum(2+).
| Compound Name | N-phenyl-6-phenyl-N-(2-phenyl-1,2-dihydropyridin-6-yl)pyridin-2-amine;platinum(2+) |
|---|---|
| PubChem CID | 170529903 |
| Molecular Formula | C28H21N3Pt |
| Molecular Weight | 594.58 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | N-phenyl-6-phenyl-N-(2-phenyl-1,2-dihydropyridin-6-yl)pyridin-2-amine;platinum(2+) |
| SMILES | [Pt+2].[c-]1ccccc1-c1cccc(N(C2=CC=CC(c3[c-]cccc3)N2)c2ccccc2)n1 |
| InChI | InChI=1S/C28H21N3.Pt/c1-4-12-22(13-5-1)25-18-10-20-27(29-25)31(24-16-8-3-9-17-24)28-21-11-19-26(30-28)23-14-6-2-7-15-23;/h1-12,14,16-21,25,29H;/q-2;+2 |
| InChIKey | JRLGRWXPMBMGIJ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.58 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|