C16H28N2O5 — CID 17053079
N-(cyclohex-3-en-1-ylmethyl)-3-morpholin-4-ylpropan-1-amine;oxalic acid (PubChem CID 17053079) has the molecular formula C16H28N2O5 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethyl)-3-morpholin-4-ylpropan-1-amine;oxalic acid.
| Compound Name | N-(cyclohex-3-en-1-ylmethyl)-3-morpholin-4-ylpropan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 17053079 |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethyl)-3-morpholin-4-ylpropan-1-amine;oxalic acid |
| SMILES | C1=CCC(CNCCCN2CCOCC2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H26N2O.C2H2O4/c1-2-5-14(6-3-1)13-15-7-4-8-16-9-11-17-12-10-16;3-1(4)2(5)6/h1-2,14-15H,3-13H2;(H,3,4)(H,5,6) |
| InChIKey | IKUGJAVBKPZKJY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|