C48H50IrN4OSi-2 — CID 170531912
1-[2,6-di(butan-2-yl)-4-methylphenyl]-2-phenylbenzimidazole;iridium;trimethyl-[6-(2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-id-8-yl)-3-pyridinyl]silane (PubChem CID 170531912) has the molecular formula C48H50IrN4OSi-2 and a molecular weight of 919.26 g/mol. Its IUPAC name is 1-[2,6-di(butan-2-yl)-4-methylphenyl]-2-phenylbenzimidazole;iridium;trimethyl-[6-(2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-id-8-yl)-3-pyridinyl]silane.
| Compound Name | 1-[2,6-di(butan-2-yl)-4-methylphenyl]-2-phenylbenzimidazole;iridium;trimethyl-[6-(2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-id-8-yl)-3-pyridinyl]silane |
|---|---|
| PubChem CID | 170531912 |
| Molecular Formula | C48H50IrN4OSi-2 |
| Molecular Weight | 919.26 g/mol |
| Exact Mass | 919.34 |
| IUPAC Name | 1-[2,6-di(butan-2-yl)-4-methylphenyl]-2-phenylbenzimidazole;iridium;trimethyl-[6-(2-methyl-7H-[1]benzofuro[2,3-b]pyridin-7-id-8-yl)-3-pyridinyl]silane |
| SMILES | CCC(C)c1cc(C)cc(C(C)CC)c1-n1c(-c2[c-]cccc2)nc2ccccc21.Cc1ccc2c(n1)oc1c(-c3ccc([Si](C)(C)C)cn3)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C28H31N2.C20H19N2OSi.Ir/c1-6-20(4)23-17-19(3)18-24(21(5)7-2)27(23)30-26-16-12-11-15-25(26)29-28(30)22-13-9-8-10-14-22;1-13-8-10-16-15-6-5-7-17(19(15)23-20(16)22-13)18-11-9-14(12-21-18)24(2,3)4;/h8-13,15-18,20-21H,6-7H2,1-5H3;5-6,8-12H,1-4H3;/q2*-1; |
| InChIKey | YVXSZGVCAWWRKI-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.26 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|