C47H40IrN4OSi-2 — CID 156670299
iridium;2-phenyl-8-[1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 156670299) has the molecular formula C47H40IrN4OSi-2 and a molecular weight of 897.17 g/mol. Its IUPAC name is iridium;2-phenyl-8-[1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | iridium;2-phenyl-8-[1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 156670299 |
| Molecular Formula | C47H40IrN4OSi-2 |
| Molecular Weight | 897.17 g/mol |
| Exact Mass | 897.26 |
| IUPAC Name | iridium;2-phenyl-8-[1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]-7H-[1]benzofuro[2,3-b]pyridin-7-ide;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.Cc1cc(C)c(-n2c(-c3[c-]ccc4c3oc3nc(-c5ccccc5)ccc34)nc3ccccc32)c(C)c1.[Ir] |
| InChI | InChI=1S/C33H24N3O.C14H16NSi.Ir/c1-20-18-21(2)30(22(3)19-20)36-29-15-8-7-14-28(29)34-32(36)26-13-9-12-24-25-16-17-27(23-10-5-4-6-11-23)35-33(25)37-31(24)26;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h4-12,14-19H,1-3H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | LPIDKJQUMCSYIT-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.17 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|