C21H28BrNO6 — CID 170533440
1-O-[3-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propyl] 5-O-methyl 4-bromo-2,2,4-trimethylpentanedioate (PubChem CID 170533440) has the molecular formula C21H28BrNO6 and a molecular weight of 470.36 g/mol. Its IUPAC name is 1-O-[3-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propyl] 5-O-methyl 4-bromo-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-[3-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propyl] 5-O-methyl 4-bromo-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 170533440 |
| Molecular Formula | C21H28BrNO6 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 1-O-[3-[(1R,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propyl] 5-O-methyl 4-bromo-2,2,4-trimethylpentanedioate |
| SMILES | COC(=O)C(C)(Br)CC(C)(C)C(=O)OCCCN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C21H28BrNO6/c1-20(2,11-21(3,22)19(27)28-4)18(26)29-9-5-8-23-16(24)14-12-6-7-13(10-12)15(14)17(23)25/h6-7,12-15H,5,8-11H2,1-4H3/t12-,13+,14+,15-,21? |
| InChIKey | RSIORXMOZLGCRF-VHEZFCPYSA-N |
| XLogP | 2.47 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|