C17H21NO7 — CID 170533442
3-[(2R,6S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propyl 2-(2-hydroxyacetyl)oxypropanoate (PubChem CID 170533442) has the molecular formula C17H21NO7 and a molecular weight of 351.36 g/mol. Its IUPAC name is 3-[(2R,6S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propyl 2-(2-hydroxyacetyl)oxypropanoate.
| Compound Name | 3-[(2R,6S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propyl 2-(2-hydroxyacetyl)oxypropanoate |
|---|---|
| PubChem CID | 170533442 |
| Molecular Formula | C17H21NO7 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 3-[(2R,6S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propyl 2-(2-hydroxyacetyl)oxypropanoate |
| SMILES | CC(OC(=O)CO)C(=O)OCCCN1C(=O)[C@@H]2C3C=CC(C3)[C@@H]2C1=O |
| InChI | InChI=1S/C17H21NO7/c1-9(25-12(20)8-19)17(23)24-6-2-5-18-15(21)13-10-3-4-11(7-10)14(13)16(18)22/h3-4,9-11,13-14,19H,2,5-8H2,1H3/t9?,10?,11?,13-,14+ |
| InChIKey | OGPZAFKFPLLMQS-DIOSFAELSA-N |
| XLogP | -0.35 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|