C27H34FN3O2 — CID 170536868
[(4aS,7R,8aS)-4-tert-butyl-1,2,3,4a,5,7,8,8a-octahydropyrano[3,4-b]pyrazin-7-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone (PubChem CID 170536868) has the molecular formula C27H34FN3O2 and a molecular weight of 451.59 g/mol. Its IUPAC name is [(4aS,7R,8aS)-4-tert-butyl-1,2,3,4a,5,7,8,8a-octahydropyrano[3,4-b]pyrazin-7-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone.
| Compound Name | [(4aS,7R,8aS)-4-tert-butyl-1,2,3,4a,5,7,8,8a-octahydropyrano[3,4-b]pyrazin-7-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 170536868 |
| Molecular Formula | C27H34FN3O2 |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | [(4aS,7R,8aS)-4-tert-butyl-1,2,3,4a,5,7,8,8a-octahydropyrano[3,4-b]pyrazin-7-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
| SMILES | CC(C)(C)N1CCN[C@H]2C[C@H](C(=O)N3CCc4ccccc4[C@@H]3c3ccc(F)cc3)OC[C@H]21 |
| InChI | InChI=1S/C27H34FN3O2/c1-27(2,3)31-15-13-29-22-16-24(33-17-23(22)31)26(32)30-14-12-18-6-4-5-7-21(18)25(30)19-8-10-20(28)11-9-19/h4-11,22-25,29H,12-17H2,1-3H3/t22-,23+,24+,25-/m0/s1 |
| InChIKey | IAQGLKVWNZRVSB-LIONHTAISA-N |
| XLogP | 3.53 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |