C23H23FN2O4 — CID 170536883
(4aS,7R)-7-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-2,4a,5,7,8,8a-hexahydro-1H-pyrano[3,4-b][1,4]oxazin-3-one (PubChem CID 170536883) has the molecular formula C23H23FN2O4 and a molecular weight of 410.45 g/mol. Its IUPAC name is (4aS,7R)-7-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-2,4a,5,7,8,8a-hexahydro-1H-pyrano[3,4-b][1,4]oxazin-3-one.
| Compound Name | (4aS,7R)-7-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-2,4a,5,7,8,8a-hexahydro-1H-pyrano[3,4-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 170536883 |
| Molecular Formula | C23H23FN2O4 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (4aS,7R)-7-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-2,4a,5,7,8,8a-hexahydro-1H-pyrano[3,4-b][1,4]oxazin-3-one |
| SMILES | O=C1CNC2C[C@H](C(=O)N3CCc4ccccc4[C@@H]3c3ccc(F)cc3)OC[C@H]2O1 |
| InChI | InChI=1S/C23H23FN2O4/c24-16-7-5-15(6-8-16)22-17-4-2-1-3-14(17)9-10-26(22)23(28)19-11-18-20(13-29-19)30-21(27)12-25-18/h1-8,18-20,22,25H,9-13H2/t18?,19-,20-,22+/m1/s1 |
| InChIKey | DOJVTFHWVOJIRG-GLUDTDLXSA-N |
| XLogP | 1.97 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |