C29H34N2O5 — CID 170541323
tert-butyl 6-[1-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropan-2-yl]-2-azaspiro[3.3]heptane-2-carboxylate (PubChem CID 170541323) has the molecular formula C29H34N2O5 and a molecular weight of 490.60 g/mol. Its IUPAC name is tert-butyl 6-[1-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropan-2-yl]-2-azaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-[1-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropan-2-yl]-2-azaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 170541323 |
| Molecular Formula | C29H34N2O5 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | tert-butyl 6-[1-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxopropan-2-yl]-2-azaspiro[3.3]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC(C(C=O)CNC(=O)OCC3c4ccccc4-c4ccccc43)C2)C1 |
| InChI | InChI=1S/C29H34N2O5/c1-28(2,3)36-27(34)31-17-29(18-31)12-19(13-29)20(15-32)14-30-26(33)35-16-25-23-10-6-4-8-21(23)22-9-5-7-11-24(22)25/h4-11,15,19-20,25H,12-14,16-18H2,1-3H3,(H,30,33) |
| InChIKey | BSIDLAFRVVQRAM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|