C23H23F6NO5S — CID 170542049
methyl 2-[(3S,5S)-1-[[4-(trifluoromethyl)phenyl]methyl]-5-[4-(trifluoromethylsulfonyloxy)phenyl]piperidin-3-yl]acetate (PubChem CID 170542049) has the molecular formula C23H23F6NO5S and a molecular weight of 539.49 g/mol. Its IUPAC name is methyl 2-[(3S,5S)-1-[[4-(trifluoromethyl)phenyl]methyl]-5-[4-(trifluoromethylsulfonyloxy)phenyl]piperidin-3-yl]acetate.
| Compound Name | methyl 2-[(3S,5S)-1-[[4-(trifluoromethyl)phenyl]methyl]-5-[4-(trifluoromethylsulfonyloxy)phenyl]piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 170542049 |
| Molecular Formula | C23H23F6NO5S |
| Molecular Weight | 539.49 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | methyl 2-[(3S,5S)-1-[[4-(trifluoromethyl)phenyl]methyl]-5-[4-(trifluoromethylsulfonyloxy)phenyl]piperidin-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C[C@@H](c2ccc(OS(=O)(=O)C(F)(F)F)cc2)CN(Cc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C23H23F6NO5S/c1-34-21(31)11-16-10-18(17-4-8-20(9-5-17)35-36(32,33)23(27,28)29)14-30(13-16)12-15-2-6-19(7-3-15)22(24,25)26/h2-9,16,18H,10-14H2,1H3/t16-,18+/m0/s1 |
| InChIKey | RHXKEDHPUAIPDH-FUHWJXTLSA-N |
| XLogP | 5.10 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|