C25H24F3NO2 — CID 169221948
2-[1-(naphthalen-2-ylmethyl)-5-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid (PubChem CID 169221948) has the molecular formula C25H24F3NO2 and a molecular weight of 427.47 g/mol. Its IUPAC name is 2-[1-(naphthalen-2-ylmethyl)-5-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[1-(naphthalen-2-ylmethyl)-5-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 169221948 |
| Molecular Formula | C25H24F3NO2 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 2-[1-(naphthalen-2-ylmethyl)-5-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CC(c2ccc(C(F)(F)F)cc2)CN(Cc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C25H24F3NO2/c26-25(27,28)23-9-7-20(8-10-23)22-12-18(13-24(30)31)15-29(16-22)14-17-5-6-19-3-1-2-4-21(19)11-17/h1-11,18,22H,12-16H2,(H,30,31) |
| InChIKey | MDKFYENNLNDDQA-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |