C55H45F3N3OPt- — CID 170542314
2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-[9-[4-(trifluoromethyl)phenyl]carbazol-3-yl]-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum (PubChem CID 170542314) has the molecular formula C55H45F3N3OPt- and a molecular weight of 1016.06 g/mol. Its IUPAC name is 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-[9-[4-(trifluoromethyl)phenyl]carbazol-3-yl]-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-[9-[4-(trifluoromethyl)phenyl]carbazol-3-yl]-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 170542314 |
| Molecular Formula | C55H45F3N3OPt- |
| Molecular Weight | 1016.06 g/mol |
| Exact Mass | 1015.32 |
| IUPAC Name | 2-[4-(3,5-ditert-butylphenyl)-6-[3-[4-[9-[4-(trifluoromethyl)phenyl]carbazol-3-yl]-2-pyridinyl]benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3[c-]c(-c4cc(-c5ccc6c(c5)c5ccccc5n6-c5ccc(C(F)(F)F)cc5)ccn4)ccc3)nc(-c3ccccc3O)c2)cc(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C55H45F3N3O.Pt/c1-53(2,3)41-27-38(28-42(33-41)54(4,5)6)39-31-48(60-49(32-39)45-15-8-10-17-52(45)62)37-13-11-12-36(26-37)47-30-35(24-25-59-47)34-18-23-51-46(29-34)44-14-7-9-16-50(44)61(51)43-21-19-40(20-22-43)55(56,57)58;/h7-25,27-33,62H,1-6H3;/q-1; |
| InChIKey | RLPMAFCODNVUSZ-UHFFFAOYSA-N |
| XLogP | 15.03 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1016.06 |
| LogP ≤ 5 | 15.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|