C28H26FN5O5S — CID 170544875
N-[[2-(6-fluoro-5-methoxy-3,4-dihydro-2H-1,8-naphthyridin-1-yl)-1,6-naphthyridin-7-yl]methyl]-1,1-dioxo-3,5-dihydro-2H-4,1λ6-benzoxathiepine-8-carboxamide (PubChem CID 170544875) has the molecular formula C28H26FN5O5S and a molecular weight of 563.61 g/mol. Its IUPAC name is N-[[2-(6-fluoro-5-methoxy-3,4-dihydro-2H-1,8-naphthyridin-1-yl)-1,6-naphthyridin-7-yl]methyl]-1,1-dioxo-3,5-dihydro-2H-4,1λ6-benzoxathiepine-8-carboxamide.
| Compound Name | N-[[2-(6-fluoro-5-methoxy-3,4-dihydro-2H-1,8-naphthyridin-1-yl)-1,6-naphthyridin-7-yl]methyl]-1,1-dioxo-3,5-dihydro-2H-4,1λ6-benzoxathiepine-8-carboxamide |
|---|---|
| PubChem CID | 170544875 |
| Molecular Formula | C28H26FN5O5S |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.16 |
| IUPAC Name | N-[[2-(6-fluoro-5-methoxy-3,4-dihydro-2H-1,8-naphthyridin-1-yl)-1,6-naphthyridin-7-yl]methyl]-1,1-dioxo-3,5-dihydro-2H-4,1λ6-benzoxathiepine-8-carboxamide |
| SMILES | COc1c(F)cnc2c1CCCN2c1ccc2cnc(CNC(=O)c3ccc4c(c3)S(=O)(=O)CCOC4)cc2n1 |
| InChI | InChI=1S/C28H26FN5O5S/c1-38-26-21-3-2-8-34(27(21)31-15-22(26)29)25-7-6-18-13-30-20(12-23(18)33-25)14-32-28(35)17-4-5-19-16-39-9-10-40(36,37)24(19)11-17/h4-7,11-13,15H,2-3,8-10,14,16H2,1H3,(H,32,35) |
| InChIKey | UQUJZNNRXORRDF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |