C29H27FN4O5S — CID 170545156
N-[[2-(8-fluoro-5-methoxy-3,4-dihydro-2H-quinolin-1-yl)-1,6-naphthyridin-7-yl]methyl]-1,1-dioxo-3,5-dihydro-2H-4,1λ6-benzoxathiepine-8-carboxamide (PubChem CID 170545156) has the molecular formula C29H27FN4O5S and a molecular weight of 562.62 g/mol. Its IUPAC name is N-[[2-(8-fluoro-5-methoxy-3,4-dihydro-2H-quinolin-1-yl)-1,6-naphthyridin-7-yl]methyl]-1,1-dioxo-3,5-dihydro-2H-4,1λ6-benzoxathiepine-8-carboxamide.
| Compound Name | N-[[2-(8-fluoro-5-methoxy-3,4-dihydro-2H-quinolin-1-yl)-1,6-naphthyridin-7-yl]methyl]-1,1-dioxo-3,5-dihydro-2H-4,1λ6-benzoxathiepine-8-carboxamide |
|---|---|
| PubChem CID | 170545156 |
| Molecular Formula | C29H27FN4O5S |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | N-[[2-(8-fluoro-5-methoxy-3,4-dihydro-2H-quinolin-1-yl)-1,6-naphthyridin-7-yl]methyl]-1,1-dioxo-3,5-dihydro-2H-4,1λ6-benzoxathiepine-8-carboxamide |
| SMILES | COc1ccc(F)c2c1CCCN2c1ccc2cnc(CNC(=O)c3ccc4c(c3)S(=O)(=O)CCOC4)cc2n1 |
| InChI | InChI=1S/C29H27FN4O5S/c1-38-25-8-7-23(30)28-22(25)3-2-10-34(28)27-9-6-19-15-31-21(14-24(19)33-27)16-32-29(35)18-4-5-20-17-39-11-12-40(36,37)26(20)13-18/h4-9,13-15H,2-3,10-12,16-17H2,1H3,(H,32,35) |
| InChIKey | FSVAFHMLVNDUPO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |