C16H30F3NO6S4 — CID 170545928
3-(trifluoromethylsulfonylsulfamoyl)propyl 3-(3-hexan-3-ylsulfanylpropylsulfanyl)propanoate (PubChem CID 170545928) has the molecular formula C16H30F3NO6S4 and a molecular weight of 517.68 g/mol. Its IUPAC name is 3-(trifluoromethylsulfonylsulfamoyl)propyl 3-(3-hexan-3-ylsulfanylpropylsulfanyl)propanoate.
| Compound Name | 3-(trifluoromethylsulfonylsulfamoyl)propyl 3-(3-hexan-3-ylsulfanylpropylsulfanyl)propanoate |
|---|---|
| PubChem CID | 170545928 |
| Molecular Formula | C16H30F3NO6S4 |
| Molecular Weight | 517.68 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 3-(trifluoromethylsulfonylsulfamoyl)propyl 3-(3-hexan-3-ylsulfanylpropylsulfanyl)propanoate |
| SMILES | CCCC(CC)SCCCSCCC(=O)OCCCS(=O)(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H30F3NO6S4/c1-3-7-14(4-2)28-11-6-10-27-12-8-15(21)26-9-5-13-29(22,23)20-30(24,25)16(17,18)19/h14,20H,3-13H2,1-2H3 |
| InChIKey | DGQIGCFBXDKLET-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.68 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|