C16H29F3NO6S4- — CID 170545927
3-[3-(3-hexan-3-ylsulfanylpropylsulfanyl)propanoyloxy]propylsulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 170545927) has the molecular formula C16H29F3NO6S4- and a molecular weight of 516.67 g/mol. Its IUPAC name is 3-[3-(3-hexan-3-ylsulfanylpropylsulfanyl)propanoyloxy]propylsulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | 3-[3-(3-hexan-3-ylsulfanylpropylsulfanyl)propanoyloxy]propylsulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 170545927 |
| Molecular Formula | C16H29F3NO6S4- |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | 3-[3-(3-hexan-3-ylsulfanylpropylsulfanyl)propanoyloxy]propylsulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | CCCC(CC)SCCCSCCC(=O)OCCCS(=O)(=O)[N-]S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H29F3NO6S4/c1-3-7-14(4-2)28-11-6-10-27-12-8-15(21)26-9-5-13-29(22,23)20-30(24,25)16(17,18)19/h14H,3-13H2,1-2H3/q-1 |
| InChIKey | RHGLHFNXJVUTEC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 108.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|