C54H59NO2 — CID 170546472
11-[2-(1-adamantyl)-6-(2-adamantyl)phenyl]-5,17-ditert-butyl-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione (PubChem CID 170546472) has the molecular formula C54H59NO2 and a molecular weight of 754.07 g/mol. Its IUPAC name is 11-[2-(1-adamantyl)-6-(2-adamantyl)phenyl]-5,17-ditert-butyl-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione.
| Compound Name | 11-[2-(1-adamantyl)-6-(2-adamantyl)phenyl]-5,17-ditert-butyl-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione |
|---|---|
| PubChem CID | 170546472 |
| Molecular Formula | C54H59NO2 |
| Molecular Weight | 754.07 g/mol |
| Exact Mass | 753.45 |
| IUPAC Name | 11-[2-(1-adamantyl)-6-(2-adamantyl)phenyl]-5,17-ditert-butyl-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione |
| SMILES | CC(C)(C)c1ccc2c(c1)c(=O)c1cc(-c3c(C4C5CC6CC(C5)CC4C6)cccc3C34CC5CC(CC(C5)C3)C4)cc3c(=O)c4cc(C(C)(C)C)ccc4n2c13 |
| InChI | InChI=1S/C54H59NO2/c1-52(2,3)37-10-12-45-40(24-37)50(56)42-22-36(23-43-49(42)55(45)46-13-11-38(53(4,5)6)25-41(46)51(43)57)48-39(47-34-18-29-14-30(20-34)21-35(47)19-29)8-7-9-44(48)54-26-31-15-32(27-54)17-33(16-31)28-54/h7-13,22-25,29-35,47H,14-21,26-28H2,1-6H3 |
| InChIKey | GTHQERYQLWFWMZ-UHFFFAOYSA-N |
| XLogP | 12.83 |
| TPSA | 38.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.07 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|