C26H23NO4 — CID 177480090
11-tert-butyl-5,17-dimethoxy-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione (PubChem CID 177480090) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is 11-tert-butyl-5,17-dimethoxy-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione.
| Compound Name | 11-tert-butyl-5,17-dimethoxy-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione |
|---|---|
| PubChem CID | 177480090 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 11-tert-butyl-5,17-dimethoxy-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-8,14-dione |
| SMILES | COc1ccc2c(c1)c(=O)c1cc(C(C)(C)C)cc3c(=O)c4cc(OC)ccc4n2c13 |
| InChI | InChI=1S/C26H23NO4/c1-26(2,3)14-10-19-23-20(11-14)25(29)18-13-16(31-5)7-9-22(18)27(23)21-8-6-15(30-4)12-17(21)24(19)28/h6-13H,1-5H3 |
| InChIKey | SEEDAQDZHZZOSN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|