C21H30ClNO3 — CID 17054714
2-[[3-ethoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]butan-1-ol;hydrochloride (PubChem CID 17054714) has the molecular formula C21H30ClNO3 and a molecular weight of 379.93 g/mol. Its IUPAC name is 2-[[3-ethoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]butan-1-ol;hydrochloride.
| Compound Name | 2-[[3-ethoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 17054714 |
| Molecular Formula | C21H30ClNO3 |
| Molecular Weight | 379.93 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2-[[3-ethoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]butan-1-ol;hydrochloride |
| SMILES | CCOc1cccc(CNC(CC)CO)c1OCc1ccc(C)cc1.Cl |
| InChI | InChI=1S/C21H29NO3.ClH/c1-4-19(14-23)22-13-18-7-6-8-20(24-5-2)21(18)25-15-17-11-9-16(3)10-12-17;/h6-12,19,22-23H,4-5,13-15H2,1-3H3;1H |
| InChIKey | AICVGAJNBQEUEE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.93 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |