C21H32Cl2N2O3 — CID 17054772
2-[2-[[3-ethoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]ethylamino]ethanol;dihydrochloride (PubChem CID 17054772) has the molecular formula C21H32Cl2N2O3 and a molecular weight of 431.40 g/mol. Its IUPAC name is 2-[2-[[3-ethoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]ethylamino]ethanol;dihydrochloride.
| Compound Name | 2-[2-[[3-ethoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]ethylamino]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 17054772 |
| Molecular Formula | C21H32Cl2N2O3 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 2-[2-[[3-ethoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]ethylamino]ethanol;dihydrochloride |
| SMILES | CCOc1cccc(CNCCNCCO)c1OCc1ccc(C)cc1.Cl.Cl |
| InChI | InChI=1S/C21H30N2O3.2ClH/c1-3-25-20-6-4-5-19(15-23-12-11-22-13-14-24)21(20)26-16-18-9-7-17(2)8-10-18;;/h4-10,22-24H,3,11-16H2,1-2H3;2*1H |
| InChIKey | VAHCOZSAPZFRIO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|