C16H7ClF5N5 — CID 170547188
11-chloro-8-(2,6-difluorophenyl)-13-(trifluoromethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaene (PubChem CID 170547188) has the molecular formula C16H7ClF5N5 and a molecular weight of 399.71 g/mol. Its IUPAC name is 11-chloro-8-(2,6-difluorophenyl)-13-(trifluoromethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaene.
| Compound Name | 11-chloro-8-(2,6-difluorophenyl)-13-(trifluoromethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaene |
|---|---|
| PubChem CID | 170547188 |
| Molecular Formula | C16H7ClF5N5 |
| Molecular Weight | 399.71 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 11-chloro-8-(2,6-difluorophenyl)-13-(trifluoromethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaene |
| SMILES | Fc1cccc(F)c1C1=Nc2c(cc(C(F)(F)F)nc2Cl)-c2[nH]ncc2N1 |
| InChI | InChI=1S/C16H7ClF5N5/c17-14-13-6(4-10(25-14)16(20,21)22)12-9(5-23-27-12)24-15(26-13)11-7(18)2-1-3-8(11)19/h1-5H,(H,23,27)(H,24,26) |
| InChIKey | LDRCLTWAXLFUEC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.71 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|