C15H8Cl2FN5 — CID 170547191
13-chloro-8-(2-chloro-6-fluorophenyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaene (PubChem CID 170547191) has the molecular formula C15H8Cl2FN5 and a molecular weight of 348.17 g/mol. Its IUPAC name is 13-chloro-8-(2-chloro-6-fluorophenyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaene.
| Compound Name | 13-chloro-8-(2-chloro-6-fluorophenyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaene |
|---|---|
| PubChem CID | 170547191 |
| Molecular Formula | C15H8Cl2FN5 |
| Molecular Weight | 348.17 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 13-chloro-8-(2-chloro-6-fluorophenyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaene |
| SMILES | Fc1cccc(Cl)c1C1=Nc2cnc(Cl)cc2-c2[nH]ncc2N1 |
| InChI | InChI=1S/C15H8Cl2FN5/c16-8-2-1-3-9(18)13(8)15-21-10-5-19-12(17)4-7(10)14-11(22-15)6-20-23-14/h1-6H,(H,20,23)(H,21,22) |
| InChIKey | CPSIOQYTDCXGJX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.17 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|